C20H26N2O — CID 139089195
2,4-ditert-butyl-6-[(E)-pyridin-2-yliminomethyl]phenol (PubChem CID 139089195) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(E)-pyridin-2-yliminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[(E)-pyridin-2-yliminomethyl]phenol |
|---|---|
| PubChem CID | 139089195 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 2,4-ditert-butyl-6-[(E)-pyridin-2-yliminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/c2ccccn2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H26N2O/c1-19(2,3)15-11-14(13-22-17-9-7-8-10-21-17)18(23)16(12-15)20(4,5)6/h7-13,23H,1-6H3/b22-13+ |
| InChIKey | QPMFUFSMOKXBKQ-LPYMAVHISA-N |
| XLogP | 5.13 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|