C7H10O4S2 — CID 139090540
methyl (1S,2S)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate (PubChem CID 139090540) has the molecular formula C7H10O4S2 and a molecular weight of 222.29 g/mol. Its IUPAC name is methyl (1S,2S)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate.
| Compound Name | methyl (1S,2S)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate |
|---|---|
| PubChem CID | 139090540 |
| Molecular Formula | C7H10O4S2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | methyl (1S,2S)-2-acetyl-1-oxo-1,3-dithiolane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(C(C)=O)SCC[S@@]1=O |
| InChI | InChI=1S/C7H10O4S2/c1-5(8)7(6(9)11-2)12-3-4-13(7)10/h3-4H2,1-2H3/t7-,13-/m0/s1 |
| InChIKey | LKDKQQJRVRNASK-CPFSXVBKSA-N |
| XLogP | -0.06 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|