C40H44O8S2 — CID 139091103
(1R,4R,6R)-1-[(4-methylphenyl)sulfonylmethyl]-6-phenylcyclohex-2-ene-1,4-diol (PubChem CID 139091103) has the molecular formula C40H44O8S2 and a molecular weight of 716.92 g/mol. Its IUPAC name is (1R,4R,6R)-1-[(4-methylphenyl)sulfonylmethyl]-6-phenylcyclohex-2-ene-1,4-diol.
| Compound Name | (1R,4R,6R)-1-[(4-methylphenyl)sulfonylmethyl]-6-phenylcyclohex-2-ene-1,4-diol |
|---|---|
| PubChem CID | 139091103 |
| Molecular Formula | C40H44O8S2 |
| Molecular Weight | 716.92 g/mol |
| Exact Mass | 716.25 |
| IUPAC Name | (1R,4R,6R)-1-[(4-methylphenyl)sulfonylmethyl]-6-phenylcyclohex-2-ene-1,4-diol |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@]2(O)C=C[C@H](O)C[C@@H]2c2ccccc2)cc1.Cc1ccc(S(=O)(=O)C[C@@]2(O)C=C[C@H](O)C[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/2C20H22O4S/c2*1-15-7-9-18(10-8-15)25(23,24)14-20(22)12-11-17(21)13-19(20)16-5-3-2-4-6-16/h2*2-12,17,19,21-22H,13-14H2,1H3/t2*17-,19+,20-/m00/s1 |
| InChIKey | IFPXMEFMKGTUQG-REXFVSELSA-N |
| XLogP | 5.21 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.92 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|