C20H20BrNO3S — CID 139091583
(4-bromophenyl)-[(3R,4S)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]methanone (PubChem CID 139091583) has the molecular formula C20H20BrNO3S and a molecular weight of 434.36 g/mol. Its IUPAC name is (4-bromophenyl)-[(3R,4S)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]methanone.
| Compound Name | (4-bromophenyl)-[(3R,4S)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 139091583 |
| Molecular Formula | C20H20BrNO3S |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | (4-bromophenyl)-[(3R,4S)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]methanone |
| SMILES | C=C[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)C[C@@H]1C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H20BrNO3S/c1-3-15-12-22(26(24,25)18-10-4-14(2)5-11-18)13-19(15)20(23)16-6-8-17(21)9-7-16/h3-11,15,19H,1,12-13H2,2H3/t15-,19+/m1/s1 |
| InChIKey | CZZTTWNGNJALOB-BEFAXECRSA-N |
| XLogP | 4.06 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|