C27H27NO3S — CID 24805978
[2-[[(3R,4Z)-4-ethylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]methyl]phenyl]-phenylmethanone (PubChem CID 24805978) has the molecular formula C27H27NO3S and a molecular weight of 445.58 g/mol. Its IUPAC name is [2-[[(3R,4Z)-4-ethylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]methyl]phenyl]-phenylmethanone.
| Compound Name | [2-[[(3R,4Z)-4-ethylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]methyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 24805978 |
| Molecular Formula | C27H27NO3S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [2-[[(3R,4Z)-4-ethylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]methyl]phenyl]-phenylmethanone |
| SMILES | C/C=C1\CN(S(=O)(=O)c2ccc(C)cc2)C[C@@H]1Cc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H27NO3S/c1-3-21-18-28(32(30,31)25-15-13-20(2)14-16-25)19-24(21)17-23-11-7-8-12-26(23)27(29)22-9-5-4-6-10-22/h3-16,24H,17-19H2,1-2H3/b21-3+/t24-/m0/s1 |
| InChIKey | UUJVCMHKTNTICW-CMJIQXNVSA-N |
| XLogP | 5.04 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|