C30H40Cl2N2O8 — CID 139091723
(1R,4R,5S)-4-(2-chloroethyl)-1-[(R)-[(1R)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 139091723) has the molecular formula C30H40Cl2N2O8 and a molecular weight of 627.56 g/mol. Its IUPAC name is (1R,4R,5S)-4-(2-chloroethyl)-1-[(R)-[(1R)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[(R)-[(1R)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 139091723 |
| Molecular Formula | C30H40Cl2N2O8 |
| Molecular Weight | 627.56 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[(R)-[(1R)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | C[C@@]12OC(=O)[C@]1([C@H](O)[C@H]1C=CCCC1)NC(=O)[C@@H]2CCCl.C[C@@]12OC(=O)[C@]1([C@H](O)[C@H]1C=CCCC1)NC(=O)[C@@H]2CCCl |
| InChI | InChI=1S/2C15H20ClNO4/c2*1-14-10(7-8-16)12(19)17-15(14,13(20)21-14)11(18)9-5-3-2-4-6-9/h2*3,5,9-11,18H,2,4,6-8H2,1H3,(H,17,19)/t2*9-,10-,11+,14-,15-/m00/s1 |
| InChIKey | WTOPYBPWYZTGJM-BWSFXABOSA-N |
| XLogP | 2.27 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|