C28H36N4O10 — CID 139093983
methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate (PubChem CID 139093983) has the molecular formula C28H36N4O10 and a molecular weight of 588.61 g/mol. Its IUPAC name is methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate.
| Compound Name | methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate |
|---|---|
| PubChem CID | 139093983 |
| Molecular Formula | C28H36N4O10 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate |
| SMILES | COC(=O)Cc1cc([N+](=O)[O-])ccc1C(=O)NC(C)(C)C.COC(=O)Cc1cc([N+](=O)[O-])ccc1C(=O)NC(C)(C)C |
| InChI | InChI=1S/2C14H18N2O5/c2*1-14(2,3)15-13(18)11-6-5-10(16(19)20)7-9(11)8-12(17)21-4/h2*5-7H,8H2,1-4H3,(H,15,18) |
| InChIKey | GMEKNIJPAKNJBP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 197.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|