methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate

C28H36N4O10 — CID 139093983

IUPACmethyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate
SMILESCOC(=O)Cc1cc([N+](=O)[O-])ccc1C(=O)NC(C)(C)C.COC(=O)Cc1cc([N+](=O)[O-])ccc1C(=O)NC(C)(C)C
InChIInChI=1S/2C14H18N2O5/c2*1-14(2,3)15-13(18)11-6-5-10(16(19)20)7-9(11)8-12(17)21-4/h2*5-7H,8H2,1-4H3,(H,15,18)
InChIKeyGMEKNIJPAKNJBP-UHFFFAOYSA-N
MW588.61 g/mol
LogP3.68
Rot. Bonds8

About methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate

methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate (PubChem CID 139093983) has the molecular formula C28H36N4O10 and a molecular weight of 588.61 g/mol. Its IUPAC name is methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate.

Molecular Properties

Compound Namemethyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate
PubChem CID139093983
Molecular FormulaC28H36N4O10
Molecular Weight588.61 g/mol
Exact Mass588.24
IUPAC Namemethyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate
SMILESCOC(=O)Cc1cc([N+](=O)[O-])ccc1C(=O)NC(C)(C)C.COC(=O)Cc1cc([N+](=O)[O-])ccc1C(=O)NC(C)(C)C
InChIInChI=1S/2C14H18N2O5/c2*1-14(2,3)15-13(18)11-6-5-10(16(19)20)7-9(11)8-12(17)21-4/h2*5-7H,8H2,1-4H3,(H,15,18)
InChIKeyGMEKNIJPAKNJBP-UHFFFAOYSA-N
XLogP3.68
TPSA197.08 Ų
H-Bond Donors2
H-Bond Acceptors10
Rotatable Bonds8
Heavy Atoms42
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500588.61
LogP ≤ 53.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 1010

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate?
The IUPAC name of methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate (CID 139093983) is methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate.
What is the SMILES notation for methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate?
The canonical SMILES for methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate is COC(=O)Cc1cc([N+](=O)[O-])ccc1C(=O)NC(C)(C)C.COC(=O)Cc1cc([N+](=O)[O-])ccc1C(=O)NC(C)(C)C.
What is the InChIKey of methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate?
The InChIKey is GMEKNIJPAKNJBP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H18N2O5/c2*1-14(2,3)15-13(18)11-6-5-10(16(19)20)7-9(11)8-12(17)21-4/h2*5-7H,8H2,1-4H3,(H,15,18).
What are the key properties of methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate?
methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate has a molecular weight of 588.61 g/mol, XLogP of 3.68, 8 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(tert-butylcarbamoyl)-5-nitrophenyl]acetate is sourced from PubChem (CID 139093983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).