C50H28F6N2O4 — CID 139094581
5-naphthalen-2-yl-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione (PubChem CID 139094581) has the molecular formula C50H28F6N2O4 and a molecular weight of 834.77 g/mol. Its IUPAC name is 5-naphthalen-2-yl-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione.
| Compound Name | 5-naphthalen-2-yl-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139094581 |
| Molecular Formula | C50H28F6N2O4 |
| Molecular Weight | 834.77 g/mol |
| Exact Mass | 834.20 |
| IUPAC Name | 5-naphthalen-2-yl-2-[4-(trifluoromethyl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc(-c3ccc4ccccc4c3)cc2C(=O)N1c1ccc(C(F)(F)F)cc1.O=C1c2ccc(-c3ccc4ccccc4c3)cc2C(=O)N1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/2C25H14F3NO2/c2*26-25(27,28)19-8-10-20(11-9-19)29-23(30)21-12-7-18(14-22(21)24(29)31)17-6-5-15-3-1-2-4-16(15)13-17/h2*1-14H |
| InChIKey | ZRZVJBQRTLUDJC-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.77 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|