C22H23NO4S — CID 139094889
(3aS,7R,7aS)-7-benzoyl-2-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one (PubChem CID 139094889) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is (3aS,7R,7aS)-7-benzoyl-2-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one.
| Compound Name | (3aS,7R,7aS)-7-benzoyl-2-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 139094889 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (3aS,7R,7aS)-7-benzoyl-2-(4-methylphenyl)sulfonyl-3a,4,5,6,7,7a-hexahydro-3H-isoindol-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]3CCC[C@@H](C(=O)c4ccccc4)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C22H23NO4S/c1-15-10-12-18(13-11-15)28(26,27)23-14-17-8-5-9-19(20(17)22(23)25)21(24)16-6-3-2-4-7-16/h2-4,6-7,10-13,17,19-20H,5,8-9,14H2,1H3/t17-,19-,20+/m1/s1 |
| InChIKey | AGSDJRWZVNQGQM-RLLQIKCJSA-N |
| XLogP | 3.44 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |