C37H36O2 — CID 139095552
2,6-ditert-butyl-4-[(7S)-6-phenyl-7H-benzo[c]xanthen-7-yl]phenol (PubChem CID 139095552) has the molecular formula C37H36O2 and a molecular weight of 512.69 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(7S)-6-phenyl-7H-benzo[c]xanthen-7-yl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(7S)-6-phenyl-7H-benzo[c]xanthen-7-yl]phenol |
|---|---|
| PubChem CID | 139095552 |
| Molecular Formula | C37H36O2 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 2,6-ditert-butyl-4-[(7S)-6-phenyl-7H-benzo[c]xanthen-7-yl]phenol |
| SMILES | CC(C)(C)c1cc([C@H]2c3ccccc3Oc3c2c(-c2ccccc2)cc2ccccc32)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C37H36O2/c1-36(2,3)29-21-25(22-30(34(29)38)37(4,5)6)32-27-18-12-13-19-31(27)39-35-26-17-11-10-16-24(26)20-28(33(32)35)23-14-8-7-9-15-23/h7-22,32,38H,1-6H3/t32-/m0/s1 |
| InChIKey | WAGYQPWKPDVMMR-YTTGMZPUSA-N |
| XLogP | 10.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |