C12H18O3 — CID 139095686
methyl (3aR,4R,5R,6R)-5-hydroxy-6-methyl-2,3,3a,4,5,6-hexahydro-1H-indene-4-carboxylate (PubChem CID 139095686) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is methyl (3aR,4R,5R,6R)-5-hydroxy-6-methyl-2,3,3a,4,5,6-hexahydro-1H-indene-4-carboxylate.
| Compound Name | methyl (3aR,4R,5R,6R)-5-hydroxy-6-methyl-2,3,3a,4,5,6-hexahydro-1H-indene-4-carboxylate |
|---|---|
| PubChem CID | 139095686 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | methyl (3aR,4R,5R,6R)-5-hydroxy-6-methyl-2,3,3a,4,5,6-hexahydro-1H-indene-4-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](O)[C@H](C)C=C2CCC[C@@H]21 |
| InChI | InChI=1S/C12H18O3/c1-7-6-8-4-3-5-9(8)10(11(7)13)12(14)15-2/h6-7,9-11,13H,3-5H2,1-2H3/t7-,9+,10-,11-/m1/s1 |
| InChIKey | JIYIKYNCBORIHJ-APHKKCJPSA-N |
| XLogP | 1.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|