C17H28O3 — CID 24808685
ethyl (1R,2R,3S)-2-hydroxy-1-(4-methylpent-3-enyl)-3-prop-1-en-2-ylcyclopentane-1-carboxylate (PubChem CID 24808685) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is ethyl (1R,2R,3S)-2-hydroxy-1-(4-methylpent-3-enyl)-3-prop-1-en-2-ylcyclopentane-1-carboxylate.
| Compound Name | ethyl (1R,2R,3S)-2-hydroxy-1-(4-methylpent-3-enyl)-3-prop-1-en-2-ylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 24808685 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | ethyl (1R,2R,3S)-2-hydroxy-1-(4-methylpent-3-enyl)-3-prop-1-en-2-ylcyclopentane-1-carboxylate |
| SMILES | C=C(C)[C@@H]1CC[C@@](CCC=C(C)C)(C(=O)OCC)[C@@H]1O |
| InChI | InChI=1S/C17H28O3/c1-6-20-16(19)17(10-7-8-12(2)3)11-9-14(13(4)5)15(17)18/h8,14-15,18H,4,6-7,9-11H2,1-3,5H3/t14-,15+,17+/m0/s1 |
| InChIKey | LUHSODXAGKMAEU-ZMSDIMECSA-N |
| XLogP | 3.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|