C48H19BF21P — CID 139098366
[(E)-2-[[2,5-bis(trifluoromethyl)phenyl]-diphenylphosphaniumyl]-2-(2-ethynylphenyl)ethenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 139098366) has the molecular formula C48H19BF21P and a molecular weight of 1036.42 g/mol. Its IUPAC name is [(E)-2-[[2,5-bis(trifluoromethyl)phenyl]-diphenylphosphaniumyl]-2-(2-ethynylphenyl)ethenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [(E)-2-[[2,5-bis(trifluoromethyl)phenyl]-diphenylphosphaniumyl]-2-(2-ethynylphenyl)ethenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 139098366 |
| Molecular Formula | C48H19BF21P |
| Molecular Weight | 1036.42 g/mol |
| Exact Mass | 1036.10 |
| IUPAC Name | [(E)-2-[[2,5-bis(trifluoromethyl)phenyl]-diphenylphosphaniumyl]-2-(2-ethynylphenyl)ethenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | C#Cc1ccccc1/C(=C\[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F)[P+](c1ccccc1)(c1ccccc1)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C48H19BF21P/c1-2-21-11-9-10-16-25(21)28(71(23-12-5-3-6-13-23,24-14-7-4-8-15-24)27-19-22(47(65,66)67)17-18-26(27)48(68,69)70)20-49(29-32(50)38(56)44(62)39(57)33(29)51,30-34(52)40(58)45(63)41(59)35(30)53)31-36(54)42(60)46(64)43(61)37(31)55/h1,3-20H/b28-20+ |
| InChIKey | REOYVBGDEPLGGO-VFCFBJKWSA-N |
| XLogP | 11.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.42 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|