C16H10F7N — CID 10405506
N-[2,5-bis(trifluoromethyl)phenyl]-1-(2-fluorophenyl)ethanimine (PubChem CID 10405506) has the molecular formula C16H10F7N and a molecular weight of 349.25 g/mol. Its IUPAC name is N-[2,5-bis(trifluoromethyl)phenyl]-1-(2-fluorophenyl)ethanimine.
| Compound Name | N-[2,5-bis(trifluoromethyl)phenyl]-1-(2-fluorophenyl)ethanimine |
|---|---|
| PubChem CID | 10405506 |
| Molecular Formula | C16H10F7N |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | N-[2,5-bis(trifluoromethyl)phenyl]-1-(2-fluorophenyl)ethanimine |
| SMILES | C/C(=N\c1cc(C(F)(F)F)ccc1C(F)(F)F)c1ccccc1F |
| InChI | InChI=1S/C16H10F7N/c1-9(11-4-2-3-5-13(11)17)24-14-8-10(15(18,19)20)6-7-12(14)16(21,22)23/h2-8H,1H3/b24-9+ |
| InChIKey | NWPZLOKEVDKTDI-PGGKNCGUSA-N |
| XLogP | 6.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|