C12H12F6N2 — CID 143549898
N,N-dimethyl-4-(trifluoromethyl)-2-(1,1,1-trifluoropropan-2-ylideneamino)aniline (PubChem CID 143549898) has the molecular formula C12H12F6N2 and a molecular weight of 298.23 g/mol. Its IUPAC name is N,N-dimethyl-4-(trifluoromethyl)-2-(1,1,1-trifluoropropan-2-ylideneamino)aniline.
| Compound Name | N,N-dimethyl-4-(trifluoromethyl)-2-(1,1,1-trifluoropropan-2-ylideneamino)aniline |
|---|---|
| PubChem CID | 143549898 |
| Molecular Formula | C12H12F6N2 |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | N,N-dimethyl-4-(trifluoromethyl)-2-(1,1,1-trifluoropropan-2-ylideneamino)aniline |
| SMILES | C/C(=N\c1cc(C(F)(F)F)ccc1N(C)C)C(F)(F)F |
| InChI | InChI=1S/C12H12F6N2/c1-7(11(13,14)15)19-9-6-8(12(16,17)18)4-5-10(9)20(2)3/h4-6H,1-3H3/b19-7+ |
| InChIKey | LLTCCLPIWKZRSJ-FBCYGCLPSA-N |
| XLogP | 4.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|