About 1-(cyclopenta-1,4-dien-1-ylmethyl)-1,2,4-triazole
1-(cyclopenta-1,4-dien-1-ylmethyl)-1,2,4-triazole (PubChem CID 139105536) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 1-(cyclopenta-1,4-dien-1-ylmethyl)-1,2,4-triazole.
Analyze 1-(cyclopenta-1,4-dien-1-ylmethyl)-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopenta-1,4-dien-1-ylmethyl)-1,2,4-triazole?
The IUPAC name of 1-(cyclopenta-1,4-dien-1-ylmethyl)-1,2,4-triazole (CID 139105536) is 1-(cyclopenta-1,4-dien-1-ylmethyl)-1,2,4-triazole.
What is the SMILES notation for 1-(cyclopenta-1,4-dien-1-ylmethyl)-1,2,4-triazole?
The canonical SMILES for 1-(cyclopenta-1,4-dien-1-ylmethyl)-1,2,4-triazole is C1=CC(Cn2cncn2)=CC1.
What is the InChIKey of 1-(cyclopenta-1,4-dien-1-ylmethyl)-1,2,4-triazole?
The InChIKey is WDMQOXKPJNXUPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c1-2-4-8(3-1)5-11-7-9-6-10-11/h1,3-4,6-7H,2,5H2.
What are the key properties of 1-(cyclopenta-1,4-dien-1-ylmethyl)-1,2,4-triazole?
1-(cyclopenta-1,4-dien-1-ylmethyl)-1,2,4-triazole has a molecular weight of 147.18 g/mol, XLogP of 1.16, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopenta-1,4-dien-1-ylmethyl)-1,2,4-triazole is sourced from PubChem (CID 139105536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).