C16H24Cl4N2O3Si2 — CID 139108519
1-[[chloromethyl-[chloromethyl-[(2-hydroxypyridin-1-ium-1-yl)methyl]-methylsilyl]oxy-methylsilyl]methyl]pyridin-1-ium-2-ol dichloride (PubChem CID 139108519) has the molecular formula C16H24Cl4N2O3Si2 and a molecular weight of 490.36 g/mol. Its IUPAC name is 1-[[chloromethyl-[chloromethyl-[(2-hydroxypyridin-1-ium-1-yl)methyl]-methylsilyl]oxy-methylsilyl]methyl]pyridin-1-ium-2-ol dichloride.
| Compound Name | 1-[[chloromethyl-[chloromethyl-[(2-hydroxypyridin-1-ium-1-yl)methyl]-methylsilyl]oxy-methylsilyl]methyl]pyridin-1-ium-2-ol dichloride |
|---|---|
| PubChem CID | 139108519 |
| Molecular Formula | C16H24Cl4N2O3Si2 |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 488.01 |
| IUPAC Name | 1-[[chloromethyl-[chloromethyl-[(2-hydroxypyridin-1-ium-1-yl)methyl]-methylsilyl]oxy-methylsilyl]methyl]pyridin-1-ium-2-ol dichloride |
| SMILES | C[Si@](CCl)(C[n+]1ccccc1O)O[Si@](C)(CCl)C[n+]1ccccc1O.[Cl-].[Cl-] |
| InChI | InChI=1S/C16H22Cl2N2O3Si2.2ClH/c1-24(11-17,13-19-9-5-3-7-15(19)21)23-25(2,12-18)14-20-10-6-4-8-16(20)22;;/h3-10H,11-14H2,1-2H3;2*1H/t24-,25+;; |
| InChIKey | DOGGEGBSASUYCX-LODPTKLDSA-N |
| XLogP | -3.82 |
| TPSA | 57.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|