About 2-chloroethyl(trimethyl)azanium;phenol;chloride
2-chloroethyl(trimethyl)azanium;phenol;chloride (PubChem CID 139335706) has the molecular formula C11H19Cl2NO
and a molecular weight of 252.19 g/mol. Its IUPAC name is 2-chloroethyl(trimethyl)azanium;phenol;chloride.
Molecular Properties
| Compound Name | 2-chloroethyl(trimethyl)azanium;phenol;chloride |
| PubChem CID | 139335706 |
| Molecular Formula | C11H19Cl2NO |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-chloroethyl(trimethyl)azanium;phenol;chloride |
| SMILES | C[N+](C)(C)CCCl.Oc1ccccc1.[Cl-] |
| InChI | InChI=1S/C6H6O.C5H13ClN.ClH/c7-6-4-2-1-3-5-6;1-7(2,3)5-4-6;/h1-5,7H;4-5H2,1-3H3;1H/q;+1;/p-1 |
| InChIKey | GUDNYWBDKBIZNG-UHFFFAOYSA-M |
| XLogP | -0.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethyl(trimethyl)azanium;phenol;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethyl(trimethyl)azanium;phenol;chloride?
The IUPAC name of 2-chloroethyl(trimethyl)azanium;phenol;chloride (CID 139335706) is 2-chloroethyl(trimethyl)azanium;phenol;chloride.
What is the SMILES notation for 2-chloroethyl(trimethyl)azanium;phenol;chloride?
The canonical SMILES for 2-chloroethyl(trimethyl)azanium;phenol;chloride is C[N+](C)(C)CCCl.Oc1ccccc1.[Cl-].
What is the InChIKey of 2-chloroethyl(trimethyl)azanium;phenol;chloride?
The InChIKey is GUDNYWBDKBIZNG-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O.C5H13ClN.ClH/c7-6-4-2-1-3-5-6;1-7(2,3)5-4-6;/h1-5,7H;4-5H2,1-3H3;1H/q;+1;/p-1.
What are the key properties of 2-chloroethyl(trimethyl)azanium;phenol;chloride?
2-chloroethyl(trimethyl)azanium;phenol;chloride has a molecular weight of 252.19 g/mol, XLogP of -0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethyl(trimethyl)azanium;phenol;chloride is sourced from PubChem (CID 139335706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).