About butanedioic acid;2-chloroethyl(trimethyl)azanium;chloride
butanedioic acid;2-chloroethyl(trimethyl)azanium;chloride (PubChem CID 159736846) has the molecular formula C9H19Cl2NO4
and a molecular weight of 276.16 g/mol. Its IUPAC name is butanedioic acid;2-chloroethyl(trimethyl)azanium;chloride.
Molecular Properties
| Compound Name | butanedioic acid;2-chloroethyl(trimethyl)azanium;chloride |
| PubChem CID | 159736846 |
| Molecular Formula | C9H19Cl2NO4 |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | butanedioic acid;2-chloroethyl(trimethyl)azanium;chloride |
| SMILES | C[N+](C)(C)CCCl.O=C(O)CCC(=O)O.[Cl-] |
| InChI | InChI=1S/C5H13ClN.C4H6O4.ClH/c1-7(2,3)5-4-6;5-3(6)1-2-4(7)8;/h4-5H2,1-3H3;1-2H2,(H,5,6)(H,7,8);1H/q+1;;/p-1 |
| InChIKey | RGJMZNUQPRWTAD-UHFFFAOYSA-M |
| XLogP | -2.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butanedioic acid;2-chloroethyl(trimethyl)azanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;2-chloroethyl(trimethyl)azanium;chloride?
The IUPAC name of butanedioic acid;2-chloroethyl(trimethyl)azanium;chloride (CID 159736846) is butanedioic acid;2-chloroethyl(trimethyl)azanium;chloride.
What is the SMILES notation for butanedioic acid;2-chloroethyl(trimethyl)azanium;chloride?
The canonical SMILES for butanedioic acid;2-chloroethyl(trimethyl)azanium;chloride is C[N+](C)(C)CCCl.O=C(O)CCC(=O)O.[Cl-].
What is the InChIKey of butanedioic acid;2-chloroethyl(trimethyl)azanium;chloride?
The InChIKey is RGJMZNUQPRWTAD-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H13ClN.C4H6O4.ClH/c1-7(2,3)5-4-6;5-3(6)1-2-4(7)8;/h4-5H2,1-3H3;1-2H2,(H,5,6)(H,7,8);1H/q+1;;/p-1.
What are the key properties of butanedioic acid;2-chloroethyl(trimethyl)azanium;chloride?
butanedioic acid;2-chloroethyl(trimethyl)azanium;chloride has a molecular weight of 276.16 g/mol, XLogP of -2.13, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;2-chloroethyl(trimethyl)azanium;chloride is sourced from PubChem (CID 159736846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).