C8H21ClN2O5P+ — CID 87279763
2-chloroethyl(trimethyl)azanium;2-(phosphonomethylamino)acetic acid (PubChem CID 87279763) has the molecular formula C8H21ClN2O5P+ and a molecular weight of 291.69 g/mol. Its IUPAC name is 2-chloroethyl(trimethyl)azanium;2-(phosphonomethylamino)acetic acid.
| Compound Name | 2-chloroethyl(trimethyl)azanium;2-(phosphonomethylamino)acetic acid |
|---|---|
| PubChem CID | 87279763 |
| Molecular Formula | C8H21ClN2O5P+ |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-chloroethyl(trimethyl)azanium;2-(phosphonomethylamino)acetic acid |
| SMILES | C[N+](C)(C)CCCl.O=C(O)CNCP(=O)(O)O |
| InChI | InChI=1S/C5H13ClN.C3H8NO5P/c1-7(2,3)5-4-6;5-3(6)1-4-2-10(7,8)9/h4-5H2,1-3H3;4H,1-2H2,(H,5,6)(H2,7,8,9)/q+1; |
| InChIKey | LQAGSHWBPYTGRQ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|