C28H37AgF2N2 — CID 139112648
silver;1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-1-ium-2-ide;difluoromethane (PubChem CID 139112648) has the molecular formula C28H37AgF2N2 and a molecular weight of 547.48 g/mol. Its IUPAC name is silver;1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-1-ium-2-ide;difluoromethane.
| Compound Name | silver;1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-1-ium-2-ide;difluoromethane |
|---|---|
| PubChem CID | 139112648 |
| Molecular Formula | C28H37AgF2N2 |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | silver;1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-1-ium-2-ide;difluoromethane |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1[c-][n+](-c2c(C(C)C)cccc2C(C)C)cc1.F[CH-]F.[Ag+] |
| InChI | InChI=1S/C27H36N2.CHF2.Ag/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;2-1-3;/h9-16,18-21H,1-8H3;1H;/q;-1;+1 |
| InChIKey | PXSNPWHPZIISKN-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|