C46H56B2FeN12Si2 — CID 139113852
iron(2+);bis(tris(3-methylpyrazol-1-yl)-[4-(2-trimethylsilylethynyl)phenyl]boranuide) (PubChem CID 139113852) has the molecular formula C46H56B2FeN12Si2 and a molecular weight of 910.68 g/mol. Its IUPAC name is iron(2+);bis(tris(3-methylpyrazol-1-yl)-[4-(2-trimethylsilylethynyl)phenyl]boranuide).
| Compound Name | iron(2+);bis(tris(3-methylpyrazol-1-yl)-[4-(2-trimethylsilylethynyl)phenyl]boranuide) |
|---|---|
| PubChem CID | 139113852 |
| Molecular Formula | C46H56B2FeN12Si2 |
| Molecular Weight | 910.68 g/mol |
| Exact Mass | 910.38 |
| IUPAC Name | iron(2+);bis(tris(3-methylpyrazol-1-yl)-[4-(2-trimethylsilylethynyl)phenyl]boranuide) |
| SMILES | Cc1ccn([B-](c2ccc(C#C[Si](C)(C)C)cc2)(n2ccc(C)n2)n2ccc(C)n2)n1.Cc1ccn([B-](c2ccc(C#C[Si](C)(C)C)cc2)(n2ccc(C)n2)n2ccc(C)n2)n1.[Fe+2] |
| InChI | InChI=1S/2C23H28BN6Si.Fe/c2*1-19-11-15-28(25-19)24(29-16-12-20(2)26-29,30-17-13-21(3)27-30)23-9-7-22(8-10-23)14-18-31(4,5)6;/h2*7-13,15-17H,1-6H3;/q2*-1;+2 |
| InChIKey | JMOSUWUJEKOXIO-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 106.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.68 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|