About bis((4-iodophenyl)-tris(3-methylpyrazol-1-yl)boranuide);iron(2+)
bis((4-iodophenyl)-tris(3-methylpyrazol-1-yl)boranuide);iron(2+) (PubChem CID 139126218) has the molecular formula C36H38B2FeI2N12
and a molecular weight of 970.06 g/mol. Its IUPAC name is bis((4-iodophenyl)-tris(3-methylpyrazol-1-yl)boranuide);iron(2+).
Molecular Properties
| Compound Name | bis((4-iodophenyl)-tris(3-methylpyrazol-1-yl)boranuide);iron(2+) |
| PubChem CID | 139126218 |
| Molecular Formula | C36H38B2FeI2N12 |
| Molecular Weight | 970.06 g/mol |
| Exact Mass | 970.10 |
| IUPAC Name | bis((4-iodophenyl)-tris(3-methylpyrazol-1-yl)boranuide);iron(2+) |
| SMILES | Cc1ccn([B-](c2ccc(I)cc2)(n2ccc(C)n2)n2ccc(C)n2)n1.Cc1ccn([B-](c2ccc(I)cc2)(n2ccc(C)n2)n2ccc(C)n2)n1.[Fe+2] |
| InChI | InChI=1S/2C18H19BIN6.Fe/c2*1-14-8-11-24(21-14)19(25-12-9-15(2)22-25,26-13-10-16(3)23-26)17-4-6-18(20)7-5-17;/h2*4-13H,1-3H3;/q2*-1;+2 |
| InChIKey | AKNHDKZRUGSAFQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 106.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 970.06 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze bis((4-iodophenyl)-tris(3-methylpyrazol-1-yl)boranuide);iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((4-iodophenyl)-tris(3-methylpyrazol-1-yl)boranuide);iron(2+)?
The IUPAC name of bis((4-iodophenyl)-tris(3-methylpyrazol-1-yl)boranuide);iron(2+) (CID 139126218) is bis((4-iodophenyl)-tris(3-methylpyrazol-1-yl)boranuide);iron(2+).
What is the SMILES notation for bis((4-iodophenyl)-tris(3-methylpyrazol-1-yl)boranuide);iron(2+)?
The canonical SMILES for bis((4-iodophenyl)-tris(3-methylpyrazol-1-yl)boranuide);iron(2+) is Cc1ccn([B-](c2ccc(I)cc2)(n2ccc(C)n2)n2ccc(C)n2)n1.Cc1ccn([B-](c2ccc(I)cc2)(n2ccc(C)n2)n2ccc(C)n2)n1.[Fe+2].
What is the InChIKey of bis((4-iodophenyl)-tris(3-methylpyrazol-1-yl)boranuide);iron(2+)?
The InChIKey is AKNHDKZRUGSAFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H19BIN6.Fe/c2*1-14-8-11-24(21-14)19(25-12-9-15(2)22-25,26-13-10-16(3)23-26)17-4-6-18(20)7-5-17;/h2*4-13H,1-3H3;/q2*-1;+2.
What are the key properties of bis((4-iodophenyl)-tris(3-methylpyrazol-1-yl)boranuide);iron(2+)?
bis((4-iodophenyl)-tris(3-methylpyrazol-1-yl)boranuide);iron(2+) has a molecular weight of 970.06 g/mol, XLogP of 5.19, 8 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis((4-iodophenyl)-tris(3-methylpyrazol-1-yl)boranuide);iron(2+) is sourced from PubChem (CID 139126218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).