About bis(tris(3-phenylpyrazol-1-yl)boranuide);ytterbium(2+)
bis(tris(3-phenylpyrazol-1-yl)boranuide);ytterbium(2+) (PubChem CID 139133856) has the molecular formula C54H44B2N12Yb
and a molecular weight of 1055.69 g/mol. Its IUPAC name is bis(tris(3-phenylpyrazol-1-yl)boranuide);ytterbium(2+).
Molecular Properties
| Compound Name | bis(tris(3-phenylpyrazol-1-yl)boranuide);ytterbium(2+) |
| PubChem CID | 139133856 |
| Molecular Formula | C54H44B2N12Yb |
| Molecular Weight | 1055.69 g/mol |
| Exact Mass | 1056.34 |
| IUPAC Name | bis(tris(3-phenylpyrazol-1-yl)boranuide);ytterbium(2+) |
| SMILES | [Yb+2].c1ccc(-c2ccn([BH-](n3ccc(-c4ccccc4)n3)n3ccc(-c4ccccc4)n3)n2)cc1.c1ccc(-c2ccn([BH-](n3ccc(-c4ccccc4)n3)n3ccc(-c4ccccc4)n3)n2)cc1 |
| InChI | InChI=1S/2C27H22BN6.Yb/c2*1-4-10-22(11-5-1)25-16-19-32(29-25)28(33-20-17-26(30-33)23-12-6-2-7-13-23)34-21-18-27(31-34)24-14-8-3-9-15-24;/h2*1-21,28H;/q2*-1;+2 |
| InChIKey | BCWPRASLXIHOPO-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 106.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1055.69 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(tris(3-phenylpyrazol-1-yl)boranuide);ytterbium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tris(3-phenylpyrazol-1-yl)boranuide);ytterbium(2+)?
The IUPAC name of bis(tris(3-phenylpyrazol-1-yl)boranuide);ytterbium(2+) (CID 139133856) is bis(tris(3-phenylpyrazol-1-yl)boranuide);ytterbium(2+).
What is the SMILES notation for bis(tris(3-phenylpyrazol-1-yl)boranuide);ytterbium(2+)?
The canonical SMILES for bis(tris(3-phenylpyrazol-1-yl)boranuide);ytterbium(2+) is [Yb+2].c1ccc(-c2ccn([BH-](n3ccc(-c4ccccc4)n3)n3ccc(-c4ccccc4)n3)n2)cc1.c1ccc(-c2ccn([BH-](n3ccc(-c4ccccc4)n3)n3ccc(-c4ccccc4)n3)n2)cc1.
What is the InChIKey of bis(tris(3-phenylpyrazol-1-yl)boranuide);ytterbium(2+)?
The InChIKey is BCWPRASLXIHOPO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C27H22BN6.Yb/c2*1-4-10-22(11-5-1)25-16-19-32(29-25)28(33-20-17-26(30-33)23-12-6-2-7-13-23)34-21-18-27(31-34)24-14-8-3-9-15-24;/h2*1-21,28H;/q2*-1;+2.
What are the key properties of bis(tris(3-phenylpyrazol-1-yl)boranuide);ytterbium(2+)?
bis(tris(3-phenylpyrazol-1-yl)boranuide);ytterbium(2+) has a molecular weight of 1055.69 g/mol, XLogP of 9.88, 12 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tris(3-phenylpyrazol-1-yl)boranuide);ytterbium(2+) is sourced from PubChem (CID 139133856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).