C38H36N4 — CID 139114628
(1Z)-1-benzylidene-3-pyrrolidin-1-ylisoindole (PubChem CID 139114628) has the molecular formula C38H36N4 and a molecular weight of 548.73 g/mol. Its IUPAC name is (1Z)-1-benzylidene-3-pyrrolidin-1-ylisoindole.
| Compound Name | (1Z)-1-benzylidene-3-pyrrolidin-1-ylisoindole |
|---|---|
| PubChem CID | 139114628 |
| Molecular Formula | C38H36N4 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | (1Z)-1-benzylidene-3-pyrrolidin-1-ylisoindole |
| SMILES | C(=C1\N=C(N2CCCC2)c2ccccc21)\c1ccccc1.C(=C1\N=C(N2CCCC2)c2ccccc21)\c1ccccc1 |
| InChI | InChI=1S/2C19H18N2/c2*1-2-8-15(9-3-1)14-18-16-10-4-5-11-17(16)19(20-18)21-12-6-7-13-21/h2*1-5,8-11,14H,6-7,12-13H2/b2*18-14- |
| InChIKey | ZCUCKUNVWZOFJG-WRIHDIQBSA-N |
| XLogP | 8.08 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|