C29H26N4O — CID 155577655
(5Z)-3-(2-aminoethyl)-5-[[4-[2-[4-(azetidin-1-yl)phenyl]ethynyl]phenyl]methylidene]-2-phenylimidazol-4-one (PubChem CID 155577655) has the molecular formula C29H26N4O and a molecular weight of 446.55 g/mol. Its IUPAC name is (5Z)-3-(2-aminoethyl)-5-[[4-[2-[4-(azetidin-1-yl)phenyl]ethynyl]phenyl]methylidene]-2-phenylimidazol-4-one.
| Compound Name | (5Z)-3-(2-aminoethyl)-5-[[4-[2-[4-(azetidin-1-yl)phenyl]ethynyl]phenyl]methylidene]-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 155577655 |
| Molecular Formula | C29H26N4O |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (5Z)-3-(2-aminoethyl)-5-[[4-[2-[4-(azetidin-1-yl)phenyl]ethynyl]phenyl]methylidene]-2-phenylimidazol-4-one |
| SMILES | NCCN1C(=O)/C(=C/c2ccc(C#Cc3ccc(N4CCC4)cc3)cc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C29H26N4O/c30-17-20-33-28(25-5-2-1-3-6-25)31-27(29(33)34)21-24-11-9-22(10-12-24)7-8-23-13-15-26(16-14-23)32-18-4-19-32/h1-3,5-6,9-16,21H,4,17-20,30H2/b27-21- |
| InChIKey | GISQRIOEBFSRPO-MEFGMAGPSA-N |
| XLogP | 3.89 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|