C12H26O6Si — CID 139115328
(2R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,5-trihydroxycyclohexan-1-one;hydrate (PubChem CID 139115328) has the molecular formula C12H26O6Si and a molecular weight of 294.42 g/mol. Its IUPAC name is (2R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,5-trihydroxycyclohexan-1-one;hydrate.
| Compound Name | (2R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,5-trihydroxycyclohexan-1-one;hydrate |
|---|---|
| PubChem CID | 139115328 |
| Molecular Formula | C12H26O6Si |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (2R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,5-trihydroxycyclohexan-1-one;hydrate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@]1(O)CC(=O)[C@H](O)C[C@H]1O.O |
| InChI | InChI=1S/C12H24O5Si.H2O/c1-11(2,3)18(4,5)17-12(16)7-9(14)8(13)6-10(12)15;/h8,10,13,15-16H,6-7H2,1-5H3;1H2/t8-,10-,12-;/m1./s1 |
| InChIKey | AYSXLFDDRDGFBS-WRXFVQHLSA-N |
| XLogP | -0.04 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|