C12H26O6Si — CID 10708954
(2R,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,6-trihydroxyhexanoic acid (PubChem CID 10708954) has the molecular formula C12H26O6Si and a molecular weight of 294.42 g/mol. Its IUPAC name is (2R,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,6-trihydroxyhexanoic acid.
| Compound Name | (2R,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,6-trihydroxyhexanoic acid |
|---|---|
| PubChem CID | 10708954 |
| Molecular Formula | C12H26O6Si |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (2R,3S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,3,6-trihydroxyhexanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CO)C[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C12H26O6Si/c1-12(2,3)19(4,5)18-8(7-13)6-9(14)10(15)11(16)17/h8-10,13-15H,6-7H2,1-5H3,(H,16,17)/t8-,9-,10+/m0/s1 |
| InChIKey | ILVWAVHGKBPNKK-LPEHRKFASA-N |
| XLogP | 0.57 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|