C33H22N2O2Si — CID 139116176
1,13-diphenyl-2,24-dioxa-26-aza-25-azonia-1-silanuidaheptacyclo[12.10.1.11,9.03,8.017,25.018,23.012,26]hexacosa-3,5,7,9,11,13,15,17(25),18,20,22-undecaene (PubChem CID 139116176) has the molecular formula C33H22N2O2Si and a molecular weight of 506.64 g/mol. Its IUPAC name is 1,13-diphenyl-2,24-dioxa-26-aza-25-azonia-1-silanuidaheptacyclo[12.10.1.11,9.03,8.017,25.018,23.012,26]hexacosa-3,5,7,9,11,13,15,17(25),18,20,22-undecaene.
| Compound Name | 1,13-diphenyl-2,24-dioxa-26-aza-25-azonia-1-silanuidaheptacyclo[12.10.1.11,9.03,8.017,25.018,23.012,26]hexacosa-3,5,7,9,11,13,15,17(25),18,20,22-undecaene |
|---|---|
| PubChem CID | 139116176 |
| Molecular Formula | C33H22N2O2Si |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 1,13-diphenyl-2,24-dioxa-26-aza-25-azonia-1-silanuidaheptacyclo[12.10.1.11,9.03,8.017,25.018,23.012,26]hexacosa-3,5,7,9,11,13,15,17(25),18,20,22-undecaene |
| SMILES | C1=CC2=[N+]3C1=C(c1ccccc1)c1ccc4n1[Si-]3(c1ccccc1)(Oc1ccccc12)Oc1ccccc1-4 |
| InChI | InChI=1S/C33H22N2O2Si/c1-3-11-23(12-4-1)33-29-21-19-27-25-15-7-9-17-31(25)36-38(34(27)29,24-13-5-2-6-14-24)35-28(20-22-30(33)35)26-16-8-10-18-32(26)37-38/h1-22H |
| InChIKey | HHKKHLHQEHZTON-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 26.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|