C19H19F3N2O8S2 — CID 139117009
dimethyl (Z)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-(thiophene-2-carbonyl)but-2-enedioate;trifluoromethanesulfonate (PubChem CID 139117009) has the molecular formula C19H19F3N2O8S2 and a molecular weight of 524.50 g/mol. Its IUPAC name is dimethyl (Z)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-(thiophene-2-carbonyl)but-2-enedioate;trifluoromethanesulfonate.
| Compound Name | dimethyl (Z)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-(thiophene-2-carbonyl)but-2-enedioate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139117009 |
| Molecular Formula | C19H19F3N2O8S2 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | dimethyl (Z)-2-[4-(dimethylamino)pyridin-1-ium-1-yl]-3-(thiophene-2-carbonyl)but-2-enedioate;trifluoromethanesulfonate |
| SMILES | COC(=O)/C(C(=O)c1cccs1)=C(/C(=O)OC)[n+]1ccc(N(C)C)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C18H19N2O5S.CHF3O3S/c1-19(2)12-7-9-20(10-8-12)15(18(23)25-4)14(17(22)24-3)16(21)13-6-5-11-26-13;2-1(3,4)8(5,6)7/h5-11H,1-4H3;(H,5,6,7)/q+1;/p-1/b15-14-; |
| InChIKey | NNGNFUMYUFUMSH-BGWNKZQTSA-M |
| XLogP | 1.59 |
| TPSA | 133.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|