About methyl 4-(dimethylamino)pyridin-1-ium-1-carboxylate;tetraphenylboranuide
methyl 4-(dimethylamino)pyridin-1-ium-1-carboxylate;tetraphenylboranuide (PubChem CID 14816794) has the molecular formula C33H33BN2O2
and a molecular weight of 500.45 g/mol. Its IUPAC name is methyl 4-(dimethylamino)pyridin-1-ium-1-carboxylate;tetraphenylboranuide.
Molecular Properties
| Compound Name | methyl 4-(dimethylamino)pyridin-1-ium-1-carboxylate;tetraphenylboranuide |
| PubChem CID | 14816794 |
| Molecular Formula | C33H33BN2O2 |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | methyl 4-(dimethylamino)pyridin-1-ium-1-carboxylate;tetraphenylboranuide |
| SMILES | COC(=O)[n+]1ccc(N(C)C)cc1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C9H13N2O2/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-10(2)8-4-6-11(7-5-8)9(12)13-3/h1-20H;4-7H,1-3H3/q-1;+1 |
| InChIKey | HZYADFQTCOOPMZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(dimethylamino)pyridin-1-ium-1-carboxylate;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(dimethylamino)pyridin-1-ium-1-carboxylate;tetraphenylboranuide?
The IUPAC name of methyl 4-(dimethylamino)pyridin-1-ium-1-carboxylate;tetraphenylboranuide (CID 14816794) is methyl 4-(dimethylamino)pyridin-1-ium-1-carboxylate;tetraphenylboranuide.
What is the SMILES notation for methyl 4-(dimethylamino)pyridin-1-ium-1-carboxylate;tetraphenylboranuide?
The canonical SMILES for methyl 4-(dimethylamino)pyridin-1-ium-1-carboxylate;tetraphenylboranuide is COC(=O)[n+]1ccc(N(C)C)cc1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of methyl 4-(dimethylamino)pyridin-1-ium-1-carboxylate;tetraphenylboranuide?
The InChIKey is HZYADFQTCOOPMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.C9H13N2O2/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-10(2)8-4-6-11(7-5-8)9(12)13-3/h1-20H;4-7H,1-3H3/q-1;+1.
What are the key properties of methyl 4-(dimethylamino)pyridin-1-ium-1-carboxylate;tetraphenylboranuide?
methyl 4-(dimethylamino)pyridin-1-ium-1-carboxylate;tetraphenylboranuide has a molecular weight of 500.45 g/mol, XLogP of 3.72, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(dimethylamino)pyridin-1-ium-1-carboxylate;tetraphenylboranuide is sourced from PubChem (CID 14816794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).