About 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one
1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 159945790) has the molecular formula C12H19N2O+
and a molecular weight of 207.30 g/mol. Its IUPAC name is 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one |
| PubChem CID | 159945790 |
| Molecular Formula | C12H19N2O+ |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CN(C)c1cc[n+](C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C12H19N2O/c1-12(2,3)11(15)14-8-6-10(7-9-14)13(4)5/h6-9H,1-5H3/q+1 |
| InChIKey | PDMDPWNIAREHMT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one?
The IUPAC name of 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one (CID 159945790) is 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one is CN(C)c1cc[n+](C(=O)C(C)(C)C)cc1.
What is the InChIKey of 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one?
The InChIKey is PDMDPWNIAREHMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N2O/c1-12(2,3)11(15)14-8-6-10(7-9-14)13(4)5/h6-9H,1-5H3/q+1.
What are the key properties of 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one?
1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one has a molecular weight of 207.30 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one is sourced from PubChem (CID 159945790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).