C12H19N2O+ — CID 159945790
1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 159945790) has the molecular formula C12H19N2O+ and a molecular weight of 207.30 g/mol. Its IUPAC name is 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 159945790 |
| Molecular Formula | C12H19N2O+ |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 1-[4-(dimethylamino)pyridin-1-ium-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CN(C)c1cc[n+](C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C12H19N2O/c1-12(2,3)11(15)14-8-6-10(7-9-14)13(4)5/h6-9H,1-5H3/q+1 |
| InChIKey | PDMDPWNIAREHMT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|