C8H10BrF2N2+ — CID 10882126
1-[bromo(difluoro)methyl]-N,N-dimethylpyridin-1-ium-4-amine (PubChem CID 10882126) has the molecular formula C8H10BrF2N2+ and a molecular weight of 252.08 g/mol. Its IUPAC name is 1-[bromo(difluoro)methyl]-N,N-dimethylpyridin-1-ium-4-amine.
| Compound Name | 1-[bromo(difluoro)methyl]-N,N-dimethylpyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 10882126 |
| Molecular Formula | C8H10BrF2N2+ |
| Molecular Weight | 252.08 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 1-[bromo(difluoro)methyl]-N,N-dimethylpyridin-1-ium-4-amine |
| SMILES | CN(C)c1cc[n+](C(F)(F)Br)cc1 |
| InChI | InChI=1S/C8H10BrF2N2/c1-12(2)7-3-5-13(6-4-7)8(9,10)11/h3-6H,1-2H3/q+1 |
| InChIKey | JITQNYXHYOWYLQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.08 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|