C10H17N2+ — CID 23279341
N,N-dimethyl-1-propan-2-ylpyridin-1-ium-4-amine (PubChem CID 23279341) has the molecular formula C10H17N2+ and a molecular weight of 165.26 g/mol. Its IUPAC name is N,N-dimethyl-1-propan-2-ylpyridin-1-ium-4-amine.
| Compound Name | N,N-dimethyl-1-propan-2-ylpyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 23279341 |
| Molecular Formula | C10H17N2+ |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.14 |
| IUPAC Name | N,N-dimethyl-1-propan-2-ylpyridin-1-ium-4-amine |
| SMILES | CC(C)[n+]1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C10H17N2/c1-9(2)12-7-5-10(6-8-12)11(3)4/h5-9H,1-4H3/q+1 |
| InChIKey | VKPRUWGPKUJDCJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|