C13H22IN2+ — CID 87431743
1-(1-iodohexyl)-N,N-dimethylpyridin-1-ium-4-amine (PubChem CID 87431743) has the molecular formula C13H22IN2+ and a molecular weight of 333.24 g/mol. Its IUPAC name is 1-(1-iodohexyl)-N,N-dimethylpyridin-1-ium-4-amine.
| Compound Name | 1-(1-iodohexyl)-N,N-dimethylpyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 87431743 |
| Molecular Formula | C13H22IN2+ |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 1-(1-iodohexyl)-N,N-dimethylpyridin-1-ium-4-amine |
| SMILES | CCCCCC(I)[n+]1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C13H22IN2/c1-4-5-6-7-13(14)16-10-8-12(9-11-16)15(2)3/h8-11,13H,4-7H2,1-3H3/q+1 |
| InChIKey | JXJTYHBHXWHXHA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|