C7H10ClN2PS2 — CID 15628430
1-[chloro(sulfido)phosphinothioyl]-N,N-dimethylpyridin-1-ium-4-amine (PubChem CID 15628430) has the molecular formula C7H10ClN2PS2 and a molecular weight of 252.73 g/mol. Its IUPAC name is 1-[chloro(sulfido)phosphinothioyl]-N,N-dimethylpyridin-1-ium-4-amine.
| Compound Name | 1-[chloro(sulfido)phosphinothioyl]-N,N-dimethylpyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 15628430 |
| Molecular Formula | C7H10ClN2PS2 |
| Molecular Weight | 252.73 g/mol |
| Exact Mass | 251.97 |
| IUPAC Name | 1-[chloro(sulfido)phosphinothioyl]-N,N-dimethylpyridin-1-ium-4-amine |
| SMILES | CN(C)c1cc[n+](P(=S)([S-])Cl)cc1 |
| InChI | InChI=1S/C7H10ClN2PS2/c1-9(2)7-3-5-10(6-4-7)11(8,12)13/h3-6H,1-2H3 |
| InChIKey | RISKNXYKIOOIGU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.73 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|