C8H11N3O — CID 151112882
4-(dimethylamino)pyridin-1-ium-1-carboximidate (PubChem CID 151112882) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 4-(dimethylamino)pyridin-1-ium-1-carboximidate.
| Compound Name | 4-(dimethylamino)pyridin-1-ium-1-carboximidate |
|---|---|
| PubChem CID | 151112882 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 4-(dimethylamino)pyridin-1-ium-1-carboximidate |
| SMILES | [H]/N=C(\[O-])[n+]1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C8H11N3O/c1-10(2)7-3-5-11(6-4-7)8(9)12/h3-6H,1-2H3,(H-,9,12) |
| InChIKey | MQNGIPOLDBJTCW-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 54.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|