C48H60Cl4N6O2P2Sn — CID 6102147
bis(4-bis[4-(dimethylamino)phenyl]phosphoryl-N,N-dimethylaniline);tetrachlorostannane (PubChem CID 6102147) has the molecular formula C48H60Cl4N6O2P2Sn and a molecular weight of 1075.52 g/mol. Its IUPAC name is bis(4-bis[4-(dimethylamino)phenyl]phosphoryl-N,N-dimethylaniline);tetrachlorostannane.
| Compound Name | bis(4-bis[4-(dimethylamino)phenyl]phosphoryl-N,N-dimethylaniline);tetrachlorostannane |
|---|---|
| PubChem CID | 6102147 |
| Molecular Formula | C48H60Cl4N6O2P2Sn |
| Molecular Weight | 1075.52 g/mol |
| Exact Mass | 1074.20 |
| IUPAC Name | bis(4-bis[4-(dimethylamino)phenyl]phosphoryl-N,N-dimethylaniline);tetrachlorostannane |
| SMILES | CN(C)c1ccc(P(=O)(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1.CN(C)c1ccc(P(=O)(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1.Cl[Sn](Cl)(Cl)Cl |
| InChI | InChI=1S/2C24H30N3OP.4ClH.Sn/c2*1-25(2)19-7-13-22(14-8-19)29(28,23-15-9-20(10-16-23)26(3)4)24-17-11-21(12-18-24)27(5)6;;;;;/h2*7-18H,1-6H3;4*1H;/q;;;;;;+4/p-4 |
| InChIKey | OFPVCHPKKOOTSV-UHFFFAOYSA-J |
| XLogP | 9.43 |
| TPSA | 53.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1075.52 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|