C35H45N3O2P2 — CID 10995607
4-[4-bis[4-(dimethylamino)phenyl]phosphorylbutyl-(4-methylphenyl)phosphoryl]-N,N-dimethylaniline (PubChem CID 10995607) has the molecular formula C35H45N3O2P2 and a molecular weight of 601.71 g/mol. Its IUPAC name is 4-[4-bis[4-(dimethylamino)phenyl]phosphorylbutyl-(4-methylphenyl)phosphoryl]-N,N-dimethylaniline.
| Compound Name | 4-[4-bis[4-(dimethylamino)phenyl]phosphorylbutyl-(4-methylphenyl)phosphoryl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 10995607 |
| Molecular Formula | C35H45N3O2P2 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | 4-[4-bis[4-(dimethylamino)phenyl]phosphorylbutyl-(4-methylphenyl)phosphoryl]-N,N-dimethylaniline |
| SMILES | Cc1ccc(P(=O)(CCCCP(=O)(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C35H45N3O2P2/c1-28-10-18-32(19-11-28)41(39,33-20-12-29(13-21-33)36(2)3)26-8-9-27-42(40,34-22-14-30(15-23-34)37(4)5)35-24-16-31(17-25-35)38(6)7/h10-25H,8-9,26-27H2,1-7H3 |
| InChIKey | HEABTIHGSDYESB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|