About N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline
N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline (PubChem CID 15533809) has the molecular formula C24H28NOP
and a molecular weight of 377.47 g/mol. Its IUPAC name is N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline.
Molecular Properties
| Compound Name | N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline |
| PubChem CID | 15533809 |
| Molecular Formula | C24H28NOP |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline |
| SMILES | CCC(CP(=O)(c1ccccc1)c1ccccc1)N(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H28NOP/c1-4-21(25(3)22-17-15-20(2)16-18-22)19-27(26,23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-18,21H,4,19H2,1-3H3 |
| InChIKey | BISJAIYFXANQFH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline?
The IUPAC name of N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline (CID 15533809) is N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline.
What is the SMILES notation for N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline?
The canonical SMILES for N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline is CCC(CP(=O)(c1ccccc1)c1ccccc1)N(C)c1ccc(C)cc1.
What is the InChIKey of N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline?
The InChIKey is BISJAIYFXANQFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28NOP/c1-4-21(25(3)22-17-15-20(2)16-18-22)19-27(26,23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-18,21H,4,19H2,1-3H3.
What are the key properties of N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline?
N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline has a molecular weight of 377.47 g/mol, XLogP of 5.22, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline is sourced from PubChem (CID 15533809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).