C24H28NOP — CID 15533809
N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline (PubChem CID 15533809) has the molecular formula C24H28NOP and a molecular weight of 377.47 g/mol. Its IUPAC name is N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline.
| Compound Name | N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline |
|---|---|
| PubChem CID | 15533809 |
| Molecular Formula | C24H28NOP |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-(1-diphenylphosphorylbutan-2-yl)-N,4-dimethylaniline |
| SMILES | CCC(CP(=O)(c1ccccc1)c1ccccc1)N(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H28NOP/c1-4-21(25(3)22-17-15-20(2)16-18-22)19-27(26,23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-18,21H,4,19H2,1-3H3 |
| InChIKey | BISJAIYFXANQFH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|