C25H32N3OP — CID 143644773
4-bis[4-(dimethylamino)phenyl]phosphoryl-N,N,3-trimethylaniline (PubChem CID 143644773) has the molecular formula C25H32N3OP and a molecular weight of 421.53 g/mol. Its IUPAC name is 4-bis[4-(dimethylamino)phenyl]phosphoryl-N,N,3-trimethylaniline.
| Compound Name | 4-bis[4-(dimethylamino)phenyl]phosphoryl-N,N,3-trimethylaniline |
|---|---|
| PubChem CID | 143644773 |
| Molecular Formula | C25H32N3OP |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 4-bis[4-(dimethylamino)phenyl]phosphoryl-N,N,3-trimethylaniline |
| SMILES | Cc1cc(N(C)C)ccc1P(=O)(c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C25H32N3OP/c1-19-18-22(28(6)7)12-17-25(19)30(29,23-13-8-20(9-14-23)26(2)3)24-15-10-21(11-16-24)27(4)5/h8-18H,1-7H3 |
| InChIKey | NGHRHYNZGAWHGT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|