C34H43N3OP2 — CID 101490463
4-[[4-(dimethylamino)phenyl]-[di(propan-2-yl)amino]phosphoryl]-3-diphenylphosphanyl-N,N-dimethylaniline (PubChem CID 101490463) has the molecular formula C34H43N3OP2 and a molecular weight of 571.69 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]-[di(propan-2-yl)amino]phosphoryl]-3-diphenylphosphanyl-N,N-dimethylaniline.
| Compound Name | 4-[[4-(dimethylamino)phenyl]-[di(propan-2-yl)amino]phosphoryl]-3-diphenylphosphanyl-N,N-dimethylaniline |
|---|---|
| PubChem CID | 101490463 |
| Molecular Formula | C34H43N3OP2 |
| Molecular Weight | 571.69 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]-[di(propan-2-yl)amino]phosphoryl]-3-diphenylphosphanyl-N,N-dimethylaniline |
| SMILES | CC(C)N(C(C)C)P(=O)(c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H43N3OP2/c1-26(2)37(27(3)4)40(38,32-22-19-28(20-23-32)35(5)6)34-24-21-29(36(7)8)25-33(34)39(30-15-11-9-12-16-30)31-17-13-10-14-18-31/h9-27H,1-8H3 |
| InChIKey | XNNXYKASSDABTL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.69 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|