C24H30N3O3P — CID 91873134
4-[[4-(dimethylamino)phenoxy]-[4-(dimethylamino)phenyl]phosphoryl]oxy-N,N-dimethylaniline (PubChem CID 91873134) has the molecular formula C24H30N3O3P and a molecular weight of 439.50 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenoxy]-[4-(dimethylamino)phenyl]phosphoryl]oxy-N,N-dimethylaniline.
| Compound Name | 4-[[4-(dimethylamino)phenoxy]-[4-(dimethylamino)phenyl]phosphoryl]oxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 91873134 |
| Molecular Formula | C24H30N3O3P |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 4-[[4-(dimethylamino)phenoxy]-[4-(dimethylamino)phenyl]phosphoryl]oxy-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(OP(=O)(Oc2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H30N3O3P/c1-25(2)19-7-13-22(14-8-19)29-31(28,24-17-11-21(12-18-24)27(5)6)30-23-15-9-20(10-16-23)26(3)4/h7-18H,1-6H3 |
| InChIKey | LYGBAEDPJPZENF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|