C48H35F12GdN2O8S4 — CID 139049263
N,N-dimethyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline;gadolinium(3+);tetrakis((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate) (PubChem CID 139049263) has the molecular formula C48H35F12GdN2O8S4 and a molecular weight of 1281.31 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline;gadolinium(3+);tetrakis((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate).
| Compound Name | N,N-dimethyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline;gadolinium(3+);tetrakis((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate) |
|---|---|
| PubChem CID | 139049263 |
| Molecular Formula | C48H35F12GdN2O8S4 |
| Molecular Weight | 1281.31 g/mol |
| Exact Mass | 1281.03 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline;gadolinium(3+);tetrakis((Z)-1,1,1-trifluoro-4-oxo-4-thiophen-2-ylbut-2-en-2-olate) |
| SMILES | CN(C)c1ccc(/C=C/c2cc[n+](C)cc2)cc1.O=C(/C=C(\[O-])C(F)(F)F)c1cccs1.O=C(/C=C(\[O-])C(F)(F)F)c1cccs1.O=C(/C=C(\[O-])C(F)(F)F)c1cccs1.O=C(/C=C(\[O-])C(F)(F)F)c1cccs1.[Gd+3] |
| InChI | InChI=1S/C16H19N2.4C8H5F3O2S.Gd/c1-17(2)16-8-6-14(7-9-16)4-5-15-10-12-18(3)13-11-15;4*9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h4-13H,1-3H3;4*1-4,13H;/q+1;;;;;+3/p-4/b;4*7-4-; |
| InChIKey | UVQNXZQUTXIARK-MCZOVQBCSA-J |
| XLogP | 9.70 |
| TPSA | 167.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1281.31 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|