C19H18O — CID 139122074
(1R,8S,13R)-13-but-3-enyltetracyclo[6.5.2.01,10.02,7]pentadeca-2,4,6,10,14-pentaen-12-one (PubChem CID 139122074) has the molecular formula C19H18O and a molecular weight of 262.35 g/mol. Its IUPAC name is (1R,8S,13R)-13-but-3-enyltetracyclo[6.5.2.01,10.02,7]pentadeca-2,4,6,10,14-pentaen-12-one.
| Compound Name | (1R,8S,13R)-13-but-3-enyltetracyclo[6.5.2.01,10.02,7]pentadeca-2,4,6,10,14-pentaen-12-one |
|---|---|
| PubChem CID | 139122074 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (1R,8S,13R)-13-but-3-enyltetracyclo[6.5.2.01,10.02,7]pentadeca-2,4,6,10,14-pentaen-12-one |
| SMILES | C=CCC[C@H]1C(=O)C=C2C[C@H]3C=C[C@]21c1ccccc13 |
| InChI | InChI=1S/C19H18O/c1-2-3-7-17-18(20)12-14-11-13-9-10-19(14,17)16-8-5-4-6-15(13)16/h2,4-6,8-10,12-13,17H,1,3,7,11H2/t13-,17+,19-/m1/s1 |
| InChIKey | MBAGLMGRTUVCPA-XVGQJIODSA-N |
| XLogP | 4.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|