C32H29NO3S — CID 139123928
[(1aR,2R,3S,7bS)-2-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-1a,2,3,7b-tetrahydronaphtho[1,2-b]azirin-3-yl]-(4-methylphenyl)methanone (PubChem CID 139123928) has the molecular formula C32H29NO3S and a molecular weight of 507.66 g/mol. Its IUPAC name is [(1aR,2R,3S,7bS)-2-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-1a,2,3,7b-tetrahydronaphtho[1,2-b]azirin-3-yl]-(4-methylphenyl)methanone.
| Compound Name | [(1aR,2R,3S,7bS)-2-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-1a,2,3,7b-tetrahydronaphtho[1,2-b]azirin-3-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 139123928 |
| Molecular Formula | C32H29NO3S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | [(1aR,2R,3S,7bS)-2-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-1a,2,3,7b-tetrahydronaphtho[1,2-b]azirin-3-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)[C@@H]2c3ccccc3[C@H]3[C@@H]([C@H]2c2ccc(C)cc2)N3S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H29NO3S/c1-20-8-14-23(15-9-20)28-29(32(34)24-16-10-21(2)11-17-24)26-6-4-5-7-27(26)30-31(28)33(30)37(35,36)25-18-12-22(3)13-19-25/h4-19,28-31H,1-3H3/t28-,29+,30-,31+,33?/m0/s1 |
| InChIKey | CFSJWWABOVMUSI-JESYUTKLSA-N |
| XLogP | 6.49 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|