C29H25NO4S — CID 145418746
3-(benzenesulfonyl)-6-methyl-1-phenyl-3a,6,7,8,9,11a-hexahydronaphtho[1,2-g]indole-10,11-dione (PubChem CID 145418746) has the molecular formula C29H25NO4S and a molecular weight of 483.59 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-6-methyl-1-phenyl-3a,6,7,8,9,11a-hexahydronaphtho[1,2-g]indole-10,11-dione.
| Compound Name | 3-(benzenesulfonyl)-6-methyl-1-phenyl-3a,6,7,8,9,11a-hexahydronaphtho[1,2-g]indole-10,11-dione |
|---|---|
| PubChem CID | 145418746 |
| Molecular Formula | C29H25NO4S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 3-(benzenesulfonyl)-6-methyl-1-phenyl-3a,6,7,8,9,11a-hexahydronaphtho[1,2-g]indole-10,11-dione |
| SMILES | CC1CCCc2c1ccc1c2C(=O)C(=O)C2C(c3ccccc3)=CN(S(=O)(=O)c3ccccc3)C12 |
| InChI | InChI=1S/C29H25NO4S/c1-18-9-8-14-22-21(18)15-16-23-25(22)28(31)29(32)26-24(19-10-4-2-5-11-19)17-30(27(23)26)35(33,34)20-12-6-3-7-13-20/h2-7,10-13,15-18,26-27H,8-9,14H2,1H3 |
| InChIKey | CRXXZAWOTDDBEG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|