C40H42N2O3 — CID 139124571
ethyl (2S)-2,3-bis(dibenzylamino)-2-(4-methoxyphenyl)propanoate (PubChem CID 139124571) has the molecular formula C40H42N2O3 and a molecular weight of 598.79 g/mol. Its IUPAC name is ethyl (2S)-2,3-bis(dibenzylamino)-2-(4-methoxyphenyl)propanoate.
| Compound Name | ethyl (2S)-2,3-bis(dibenzylamino)-2-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 139124571 |
| Molecular Formula | C40H42N2O3 |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | ethyl (2S)-2,3-bis(dibenzylamino)-2-(4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)[C@@](CN(Cc1ccccc1)Cc1ccccc1)(c1ccc(OC)cc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C40H42N2O3/c1-3-45-39(43)40(37-24-26-38(44-2)27-25-37,42(30-35-20-12-6-13-21-35)31-36-22-14-7-15-23-36)32-41(28-33-16-8-4-9-17-33)29-34-18-10-5-11-19-34/h4-27H,3,28-32H2,1-2H3/t40-/m1/s1 |
| InChIKey | UHMIIPGOYUWHDR-RRHRGVEJSA-N |
| XLogP | 7.86 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |