C17H29BO2 — CID 139124851
2-[(2E,4E)-5-cyclohexylpenta-2,4-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 139124851) has the molecular formula C17H29BO2 and a molecular weight of 276.23 g/mol. Its IUPAC name is 2-[(2E,4E)-5-cyclohexylpenta-2,4-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(2E,4E)-5-cyclohexylpenta-2,4-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 139124851 |
| Molecular Formula | C17H29BO2 |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 2-[(2E,4E)-5-cyclohexylpenta-2,4-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C/C(=C/C=C/C1CCCCC1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H29BO2/c1-14(10-9-13-15-11-7-6-8-12-15)18-19-16(2,3)17(4,5)20-18/h9-10,13,15H,6-8,11-12H2,1-5H3/b13-9+,14-10- |
| InChIKey | CIEXVPWSABPHFM-ITAGJCAXSA-N |
| XLogP | 4.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|