C40H24F6O6 — CID 139125507
bis[(2,4,6-trifluorophenyl)methyl] 2,5-bis[2-(4-methoxyphenyl)ethynyl]benzene-1,4-dicarboxylate (PubChem CID 139125507) has the molecular formula C40H24F6O6 and a molecular weight of 714.61 g/mol. Its IUPAC name is bis[(2,4,6-trifluorophenyl)methyl] 2,5-bis[2-(4-methoxyphenyl)ethynyl]benzene-1,4-dicarboxylate.
| Compound Name | bis[(2,4,6-trifluorophenyl)methyl] 2,5-bis[2-(4-methoxyphenyl)ethynyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 139125507 |
| Molecular Formula | C40H24F6O6 |
| Molecular Weight | 714.61 g/mol |
| Exact Mass | 714.15 |
| IUPAC Name | bis[(2,4,6-trifluorophenyl)methyl] 2,5-bis[2-(4-methoxyphenyl)ethynyl]benzene-1,4-dicarboxylate |
| SMILES | COc1ccc(C#Cc2cc(C(=O)OCc3c(F)cc(F)cc3F)c(C#Cc3ccc(OC)cc3)cc2C(=O)OCc2c(F)cc(F)cc2F)cc1 |
| InChI | InChI=1S/C40H24F6O6/c1-49-29-11-5-23(6-12-29)3-9-25-15-32(40(48)52-22-34-37(45)19-28(42)20-38(34)46)26(10-4-24-7-13-30(50-2)14-8-24)16-31(25)39(47)51-21-33-35(43)17-27(41)18-36(33)44/h5-8,11-20H,21-22H2,1-2H3 |
| InChIKey | QCCCKVZWJXNUHR-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.61 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|